C14H17BrN4O4S2 — CID 24533063
N-[2-[5-[[(4-bromo-1-methylpyrrole-2-carbonyl)amino]carbamoyl]thiophen-2-yl]ethyl]methanesulfonamide (PubChem CID 24533063) has the molecular formula C14H17BrN4O4S2 and a molecular weight of 449.35 g/mol. Its IUPAC name is N-[2-[5-[[(4-bromo-1-methylpyrrole-2-carbonyl)amino]carbamoyl]thiophen-2-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[5-[[(4-bromo-1-methylpyrrole-2-carbonyl)amino]carbamoyl]thiophen-2-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 24533063 |
| Molecular Formula | C14H17BrN4O4S2 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | N-[2-[5-[[(4-bromo-1-methylpyrrole-2-carbonyl)amino]carbamoyl]thiophen-2-yl]ethyl]methanesulfonamide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)c1ccc(CCNS(C)(=O)=O)s1 |
| InChI | InChI=1S/C14H17BrN4O4S2/c1-19-8-9(15)7-11(19)13(20)17-18-14(21)12-4-3-10(24-12)5-6-16-25(2,22)23/h3-4,7-8,16H,5-6H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | XWDKYAPGXRYMME-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|