C18H18FNO5S2 — CID 27315933
[2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 27315933) has the molecular formula C18H18FNO5S2 and a molecular weight of 411.48 g/mol. Its IUPAC name is [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 27315933 |
| Molecular Formula | C18H18FNO5S2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | CS(=O)(=O)NCCc1ccc(C(=O)COC(=O)/C=C/c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C18H18FNO5S2/c1-27(23,24)20-11-10-15-7-8-17(26-15)16(21)12-25-18(22)9-4-13-2-5-14(19)6-3-13/h2-9,20H,10-12H2,1H3/b9-4+ |
| InChIKey | RSVWTQDISDWQGU-RUDMXATFSA-N |
| XLogP | 2.42 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|