C17H18ClNO6S2 — CID 27313704
[2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] 2-(4-chlorophenoxy)acetate (PubChem CID 27313704) has the molecular formula C17H18ClNO6S2 and a molecular weight of 431.92 g/mol. Its IUPAC name is [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] 2-(4-chlorophenoxy)acetate.
| Compound Name | [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] 2-(4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 27313704 |
| Molecular Formula | C17H18ClNO6S2 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] 2-(4-chlorophenoxy)acetate |
| SMILES | CS(=O)(=O)NCCc1ccc(C(=O)COC(=O)COc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C17H18ClNO6S2/c1-27(22,23)19-9-8-14-6-7-16(26-14)15(20)10-25-17(21)11-24-13-4-2-12(18)3-5-13/h2-7,19H,8-11H2,1H3 |
| InChIKey | UWNXAORGDSLTDB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |