C14H21NO5S3 — CID 75386503
[2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] 2-methylsulfanylbutanoate (PubChem CID 75386503) has the molecular formula C14H21NO5S3 and a molecular weight of 379.53 g/mol. Its IUPAC name is [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] 2-methylsulfanylbutanoate.
| Compound Name | [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] 2-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 75386503 |
| Molecular Formula | C14H21NO5S3 |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] 2-methylsulfanylbutanoate |
| SMILES | CCC(SC)C(=O)OCC(=O)c1ccc(CCNS(C)(=O)=O)s1 |
| InChI | InChI=1S/C14H21NO5S3/c1-4-12(21-2)14(17)20-9-11(16)13-6-5-10(22-13)7-8-15-23(3,18)19/h5-6,12,15H,4,7-9H2,1-3H3 |
| InChIKey | AGCFDUHOYRLHTL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |