C16H19NO6S3 — CID 55450165
N-[2-[5-[2-(4-methylsulfonylphenoxy)acetyl]thiophen-2-yl]ethyl]methanesulfonamide (PubChem CID 55450165) has the molecular formula C16H19NO6S3 and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[2-[5-[2-(4-methylsulfonylphenoxy)acetyl]thiophen-2-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[5-[2-(4-methylsulfonylphenoxy)acetyl]thiophen-2-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 55450165 |
| Molecular Formula | C16H19NO6S3 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | N-[2-[5-[2-(4-methylsulfonylphenoxy)acetyl]thiophen-2-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCc1ccc(C(=O)COc2ccc(S(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C16H19NO6S3/c1-25(19,20)14-6-3-12(4-7-14)23-11-15(18)16-8-5-13(24-16)9-10-17-26(2,21)22/h3-8,17H,9-11H2,1-2H3 |
| InChIKey | NGWMPOTYUVMJAZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |