C17H18N2O7S2 — CID 27353986
[2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] 4-methyl-3-nitrobenzoate (PubChem CID 27353986) has the molecular formula C17H18N2O7S2 and a molecular weight of 426.47 g/mol. Its IUPAC name is [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] 4-methyl-3-nitrobenzoate.
| Compound Name | [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 27353986 |
| Molecular Formula | C17H18N2O7S2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] 4-methyl-3-nitrobenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)c2ccc(CCNS(C)(=O)=O)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O7S2/c1-11-3-4-12(9-14(11)19(22)23)17(21)26-10-15(20)16-6-5-13(27-16)7-8-18-28(2,24)25/h3-6,9,18H,7-8,10H2,1-2H3 |
| InChIKey | HOBYXYACSOYTGY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|