C18H23NO3S3 — CID 39044976
N-[2-[5-[2-(4-propan-2-ylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide (PubChem CID 39044976) has the molecular formula C18H23NO3S3 and a molecular weight of 397.59 g/mol. Its IUPAC name is N-[2-[5-[2-(4-propan-2-ylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[5-[2-(4-propan-2-ylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 39044976 |
| Molecular Formula | C18H23NO3S3 |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-[2-[5-[2-(4-propan-2-ylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide |
| SMILES | CC(C)c1ccc(SCC(=O)c2ccc(CCNS(C)(=O)=O)s2)cc1 |
| InChI | InChI=1S/C18H23NO3S3/c1-13(2)14-4-6-15(7-5-14)23-12-17(20)18-9-8-16(24-18)10-11-19-25(3,21)22/h4-9,13,19H,10-12H2,1-3H3 |
| InChIKey | VXAIZCYDKZWHJA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |