C21H23N3O5S2 — CID 24526754
[2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate (PubChem CID 24526754) has the molecular formula C21H23N3O5S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate.
| Compound Name | [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 24526754 |
| Molecular Formula | C21H23N3O5S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate |
| SMILES | CN(C)c1ccc(/C=C(\C#N)C(=O)OCC(=O)c2ccc(CCNS(C)(=O)=O)s2)cc1 |
| InChI | InChI=1S/C21H23N3O5S2/c1-24(2)17-6-4-15(5-7-17)12-16(13-22)21(26)29-14-19(25)20-9-8-18(30-20)10-11-23-31(3,27)28/h4-9,12,23H,10-11,14H2,1-3H3/b16-12+ |
| InChIKey | VZNCSSJYEGQSJB-FOWTUZBSSA-N |
| XLogP | 2.24 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|