C17H28N2O4S2 — CID 24532565
N-(3-cyclohexyloxypropyl)-5-[2-(methanesulfonamido)ethyl]thiophene-2-carboxamide (PubChem CID 24532565) has the molecular formula C17H28N2O4S2 and a molecular weight of 388.56 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-5-[2-(methanesulfonamido)ethyl]thiophene-2-carboxamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-5-[2-(methanesulfonamido)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24532565 |
| Molecular Formula | C17H28N2O4S2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-5-[2-(methanesulfonamido)ethyl]thiophene-2-carboxamide |
| SMILES | CS(=O)(=O)NCCc1ccc(C(=O)NCCCOC2CCCCC2)s1 |
| InChI | InChI=1S/C17H28N2O4S2/c1-25(21,22)19-12-10-15-8-9-16(24-15)17(20)18-11-5-13-23-14-6-3-2-4-7-14/h8-9,14,19H,2-7,10-13H2,1H3,(H,18,20) |
| InChIKey | KFQBTWCYAXNIGF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|