C19H29NO4S — CID 39950494
N-(3-cyclohexyloxypropyl)-2-propan-2-ylsulfonylbenzamide (PubChem CID 39950494) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-2-propan-2-ylsulfonylbenzamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-2-propan-2-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 39950494 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-2-propan-2-ylsulfonylbenzamide |
| SMILES | CC(C)S(=O)(=O)c1ccccc1C(=O)NCCCOC1CCCCC1 |
| InChI | InChI=1S/C19H29NO4S/c1-15(2)25(22,23)18-12-7-6-11-17(18)19(21)20-13-8-14-24-16-9-4-3-5-10-16/h6-7,11-12,15-16H,3-5,8-10,13-14H2,1-2H3,(H,20,21) |
| InChIKey | LRKMEEOYINBLRX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|