C15H22BrNO2S — CID 79987057
5-bromo-N-(3-cyclohexyloxypropyl)-4-methylthiophene-2-carboxamide (PubChem CID 79987057) has the molecular formula C15H22BrNO2S and a molecular weight of 360.32 g/mol. Its IUPAC name is 5-bromo-N-(3-cyclohexyloxypropyl)-4-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(3-cyclohexyloxypropyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79987057 |
| Molecular Formula | C15H22BrNO2S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 5-bromo-N-(3-cyclohexyloxypropyl)-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCOC2CCCCC2)sc1Br |
| InChI | InChI=1S/C15H22BrNO2S/c1-11-10-13(20-14(11)16)15(18)17-8-5-9-19-12-6-3-2-4-7-12/h10,12H,2-9H2,1H3,(H,17,18) |
| InChIKey | ZXNYNCRTQUPTHJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|