C12H18BrNO3S — CID 79952577
5-bromo-N-[3-(2-methoxyethoxy)propyl]-4-methylthiophene-2-carboxamide (PubChem CID 79952577) has the molecular formula C12H18BrNO3S and a molecular weight of 336.25 g/mol. Its IUPAC name is 5-bromo-N-[3-(2-methoxyethoxy)propyl]-4-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[3-(2-methoxyethoxy)propyl]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79952577 |
| Molecular Formula | C12H18BrNO3S |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 5-bromo-N-[3-(2-methoxyethoxy)propyl]-4-methylthiophene-2-carboxamide |
| SMILES | COCCOCCCNC(=O)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C12H18BrNO3S/c1-9-8-10(18-11(9)13)12(15)14-4-3-5-17-7-6-16-2/h8H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | NCWRRCDYQIOUCI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|