C10H14BrNO3S — CID 79989675
5-bromo-N-(2,2-dimethoxyethyl)-4-methylthiophene-2-carboxamide (PubChem CID 79989675) has the molecular formula C10H14BrNO3S and a molecular weight of 308.20 g/mol. Its IUPAC name is 5-bromo-N-(2,2-dimethoxyethyl)-4-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(2,2-dimethoxyethyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79989675 |
| Molecular Formula | C10H14BrNO3S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 5-bromo-N-(2,2-dimethoxyethyl)-4-methylthiophene-2-carboxamide |
| SMILES | COC(CNC(=O)c1cc(C)c(Br)s1)OC |
| InChI | InChI=1S/C10H14BrNO3S/c1-6-4-7(16-9(6)11)10(13)12-5-8(14-2)15-3/h4,8H,5H2,1-3H3,(H,12,13) |
| InChIKey | PWCGKLNJVRYSRA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|