C14H23BrN2OS — CID 79964067
5-bromo-N-[2-[di(propan-2-yl)amino]ethyl]-4-methylthiophene-2-carboxamide (PubChem CID 79964067) has the molecular formula C14H23BrN2OS and a molecular weight of 347.32 g/mol. Its IUPAC name is 5-bromo-N-[2-[di(propan-2-yl)amino]ethyl]-4-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[di(propan-2-yl)amino]ethyl]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79964067 |
| Molecular Formula | C14H23BrN2OS |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 5-bromo-N-[2-[di(propan-2-yl)amino]ethyl]-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCN(C(C)C)C(C)C)sc1Br |
| InChI | InChI=1S/C14H23BrN2OS/c1-9(2)17(10(3)4)7-6-16-14(18)12-8-11(5)13(15)19-12/h8-10H,6-7H2,1-5H3,(H,16,18) |
| InChIKey | JNOKRUVHMMYXIR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |