C13H20BrN3OS — CID 79964784
5-bromo-4-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]thiophene-2-carboxamide (PubChem CID 79964784) has the molecular formula C13H20BrN3OS and a molecular weight of 346.29 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-4-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79964784 |
| Molecular Formula | C13H20BrN3OS |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 5-bromo-4-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCN2CCN(C)CC2)sc1Br |
| InChI | InChI=1S/C13H20BrN3OS/c1-10-9-11(19-12(10)14)13(18)15-3-4-17-7-5-16(2)6-8-17/h9H,3-8H2,1-2H3,(H,15,18) |
| InChIKey | FSKJDBUDMLCWKV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |