C11H13BrF3NOS — CID 115491639
5-bromo-4-methyl-N-(5,5,5-trifluoropentyl)thiophene-2-carboxamide (PubChem CID 115491639) has the molecular formula C11H13BrF3NOS and a molecular weight of 344.20 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(5,5,5-trifluoropentyl)thiophene-2-carboxamide.
| Compound Name | 5-bromo-4-methyl-N-(5,5,5-trifluoropentyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 115491639 |
| Molecular Formula | C11H13BrF3NOS |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 5-bromo-4-methyl-N-(5,5,5-trifluoropentyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCCC(F)(F)F)sc1Br |
| InChI | InChI=1S/C11H13BrF3NOS/c1-7-6-8(18-9(7)12)10(17)16-5-3-2-4-11(13,14)15/h6H,2-5H2,1H3,(H,16,17) |
| InChIKey | QXVSQJHMOXRMPS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|