C11H15BrClNOS — CID 115364639
5-bromo-N-(3-chloro-2,2-dimethylpropyl)-4-methylthiophene-2-carboxamide (PubChem CID 115364639) has the molecular formula C11H15BrClNOS and a molecular weight of 324.67 g/mol. Its IUPAC name is 5-bromo-N-(3-chloro-2,2-dimethylpropyl)-4-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(3-chloro-2,2-dimethylpropyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 115364639 |
| Molecular Formula | C11H15BrClNOS |
| Molecular Weight | 324.67 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | 5-bromo-N-(3-chloro-2,2-dimethylpropyl)-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(C)(C)CCl)sc1Br |
| InChI | InChI=1S/C11H15BrClNOS/c1-7-4-8(16-9(7)12)10(15)14-6-11(2,3)5-13/h4H,5-6H2,1-3H3,(H,14,15) |
| InChIKey | AOYSHNNNDHIZMP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.67 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|