C14H16F3NO2S — CID 115521791
5-(3-hydroxyprop-1-ynyl)-4-methyl-N-(5,5,5-trifluoropentyl)thiophene-2-carboxamide (PubChem CID 115521791) has the molecular formula C14H16F3NO2S and a molecular weight of 319.35 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-4-methyl-N-(5,5,5-trifluoropentyl)thiophene-2-carboxamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-4-methyl-N-(5,5,5-trifluoropentyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 115521791 |
| Molecular Formula | C14H16F3NO2S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-4-methyl-N-(5,5,5-trifluoropentyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCCC(F)(F)F)sc1C#CCO |
| InChI | InChI=1S/C14H16F3NO2S/c1-10-9-12(21-11(10)5-4-8-19)13(20)18-7-3-2-6-14(15,16)17/h9,19H,2-3,6-8H2,1H3,(H,18,20) |
| InChIKey | KCADMQHZNAGOFX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|