C14H19NO2S — CID 79981172
N-butyl-5-(4-hydroxybut-1-ynyl)-4-methylthiophene-2-carboxamide (PubChem CID 79981172) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is N-butyl-5-(4-hydroxybut-1-ynyl)-4-methylthiophene-2-carboxamide.
| Compound Name | N-butyl-5-(4-hydroxybut-1-ynyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79981172 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-butyl-5-(4-hydroxybut-1-ynyl)-4-methylthiophene-2-carboxamide |
| SMILES | CCCCNC(=O)c1cc(C)c(C#CCCO)s1 |
| InChI | InChI=1S/C14H19NO2S/c1-3-4-8-15-14(17)13-10-11(2)12(18-13)7-5-6-9-16/h10,16H,3-4,6,8-9H2,1-2H3,(H,15,17) |
| InChIKey | ZLDHZOLPPTVQLV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|