C11H11F2NO2S — CID 113303985
N-(2,2-difluoroethyl)-5-(3-hydroxyprop-1-ynyl)-4-methylthiophene-2-carboxamide (PubChem CID 113303985) has the molecular formula C11H11F2NO2S and a molecular weight of 259.28 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-5-(3-hydroxyprop-1-ynyl)-4-methylthiophene-2-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-5-(3-hydroxyprop-1-ynyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 113303985 |
| Molecular Formula | C11H11F2NO2S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | N-(2,2-difluoroethyl)-5-(3-hydroxyprop-1-ynyl)-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(F)F)sc1C#CCO |
| InChI | InChI=1S/C11H11F2NO2S/c1-7-5-9(11(16)14-6-10(12)13)17-8(7)3-2-4-15/h5,10,15H,4,6H2,1H3,(H,14,16) |
| InChIKey | GXSMAMMATJLCOB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|