C12H13F3N2OS — CID 79990588
5-(3-aminoprop-1-ynyl)-4-methyl-N-(3,3,3-trifluoropropyl)thiophene-2-carboxamide (PubChem CID 79990588) has the molecular formula C12H13F3N2OS and a molecular weight of 290.31 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-4-methyl-N-(3,3,3-trifluoropropyl)thiophene-2-carboxamide.
| Compound Name | 5-(3-aminoprop-1-ynyl)-4-methyl-N-(3,3,3-trifluoropropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79990588 |
| Molecular Formula | C12H13F3N2OS |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-4-methyl-N-(3,3,3-trifluoropropyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCC(F)(F)F)sc1C#CCN |
| InChI | InChI=1S/C12H13F3N2OS/c1-8-7-10(19-9(8)3-2-5-16)11(18)17-6-4-12(13,14)15/h7H,4-6,16H2,1H3,(H,17,18) |
| InChIKey | HMJGTNGGMLLQCS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|