C27H29NO5S — CID 18635905
[(2R,4aR)-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 1-amino-4-methylsulfanyl-9,10-dioxoanthracene-2-carboxylate (PubChem CID 18635905) has the molecular formula C27H29NO5S and a molecular weight of 479.60 g/mol. Its IUPAC name is [(2R,4aR)-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 1-amino-4-methylsulfanyl-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [(2R,4aR)-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 1-amino-4-methylsulfanyl-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 18635905 |
| Molecular Formula | C27H29NO5S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | [(2R,4aR)-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 1-amino-4-methylsulfanyl-9,10-dioxoanthracene-2-carboxylate |
| SMILES | COC1CCC2C[C@H](OC(=O)c3cc(SC)c4c(c3N)C(=O)c3ccccc3C4=O)CC[C@@H]2C1 |
| InChI | InChI=1S/C27H29NO5S/c1-32-16-9-7-15-12-17(10-8-14(15)11-16)33-27(31)20-13-21(34-2)22-23(24(20)28)26(30)19-6-4-3-5-18(19)25(22)29/h3-6,13-17H,7-12,28H2,1-2H3/t14-,15?,16?,17-/m1/s1 |
| InChIKey | PPJUAMYMJDMAHT-RDHHWEPZSA-N |
| XLogP | 4.91 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|