C33H33FN2O5 — CID 18635899
[(2R,4aR)-6-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 1-amino-4-(4-ethoxyanilino)-9,10-dioxoanthracene-2-carboxylate (PubChem CID 18635899) has the molecular formula C33H33FN2O5 and a molecular weight of 556.63 g/mol. Its IUPAC name is [(2R,4aR)-6-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 1-amino-4-(4-ethoxyanilino)-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [(2R,4aR)-6-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 1-amino-4-(4-ethoxyanilino)-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 18635899 |
| Molecular Formula | C33H33FN2O5 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | [(2R,4aR)-6-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 1-amino-4-(4-ethoxyanilino)-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CCOc1ccc(Nc2cc(C(=O)O[C@@H]3CC[C@@H]4CC(F)CCC4C3)c(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C33H33FN2O5/c1-2-40-22-13-10-21(11-14-22)36-27-17-26(33(39)41-23-12-8-18-15-20(34)9-7-19(18)16-23)30(35)29-28(27)31(37)24-5-3-4-6-25(24)32(29)38/h3-6,10-11,13-14,17-20,23,36H,2,7-9,12,15-16,35H2,1H3/t18-,19?,20?,23-/m1/s1 |
| InChIKey | SDQQKUMLAXIJMY-LYCVCJOSSA-N |
| XLogP | 6.65 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|