C25H25ClN2O4 — CID 14645649
(6-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate (PubChem CID 14645649) has the molecular formula C25H25ClN2O4 and a molecular weight of 452.94 g/mol. Its IUPAC name is (6-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | (6-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 14645649 |
| Molecular Formula | C25H25ClN2O4 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (6-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate |
| SMILES | Nc1cc(C(=O)OC2CCC3CC(Cl)CCC3C2)c(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H25ClN2O4/c26-14-7-5-13-10-15(8-6-12(13)9-14)32-25(31)18-11-19(27)20-21(22(18)28)24(30)17-4-2-1-3-16(17)23(20)29/h1-4,11-15H,5-10,27-28H2 |
| InChIKey | YNNSHLQPUATLCT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|