C63H72N2O6 — CID 172539118
4-(4-butylanilino)-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-1,5-dihydroxy-8-(2-methylanilino)anthracene-9,10-dione (PubChem CID 172539118) has the molecular formula C63H72N2O6 and a molecular weight of 953.28 g/mol. Its IUPAC name is 4-(4-butylanilino)-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-1,5-dihydroxy-8-(2-methylanilino)anthracene-9,10-dione.
| Compound Name | 4-(4-butylanilino)-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-1,5-dihydroxy-8-(2-methylanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 172539118 |
| Molecular Formula | C63H72N2O6 |
| Molecular Weight | 953.28 g/mol |
| Exact Mass | 952.54 |
| IUPAC Name | 4-(4-butylanilino)-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-1,5-dihydroxy-8-(2-methylanilino)anthracene-9,10-dione |
| SMILES | CCCCc1ccc(Nc2cc(Oc3ccc(C4CCC(CCCC)CC4)cc3)c(O)c3c2C(=O)c2c(O)c(Oc4ccc(C5CCC(CCCC)CC5)cc4)cc(Nc4ccccc4C)c2C3=O)cc1 |
| InChI | InChI=1S/C63H72N2O6/c1-5-8-14-41-18-24-44(25-19-41)46-28-34-49(35-29-46)70-54-38-52(64-48-32-22-43(23-33-48)16-10-7-3)56-58(60(54)66)63(69)57-53(65-51-17-12-11-13-40(51)4)39-55(61(67)59(57)62(56)68)71-50-36-30-47(31-37-50)45-26-20-42(21-27-45)15-9-6-2/h11-13,17,22-23,28-39,41-42,44-45,64-67H,5-10,14-16,18-21,24-27H2,1-4H3 |
| InChIKey | ALWFGNCECHXJIK-UHFFFAOYSA-N |
| XLogP | 17.52 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.28 |
| LogP ≤ 5 | 17.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|