C65H75FN2O6 — CID 172539133
2,6-bis[4-(4-butylcyclohexyl)phenoxy]-4-(4-fluoroanilino)-8-(4-heptylanilino)-1,5-dihydroxyanthracene-9,10-dione (PubChem CID 172539133) has the molecular formula C65H75FN2O6 and a molecular weight of 999.32 g/mol. Its IUPAC name is 2,6-bis[4-(4-butylcyclohexyl)phenoxy]-4-(4-fluoroanilino)-8-(4-heptylanilino)-1,5-dihydroxyanthracene-9,10-dione.
| Compound Name | 2,6-bis[4-(4-butylcyclohexyl)phenoxy]-4-(4-fluoroanilino)-8-(4-heptylanilino)-1,5-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 172539133 |
| Molecular Formula | C65H75FN2O6 |
| Molecular Weight | 999.32 g/mol |
| Exact Mass | 998.56 |
| IUPAC Name | 2,6-bis[4-(4-butylcyclohexyl)phenoxy]-4-(4-fluoroanilino)-8-(4-heptylanilino)-1,5-dihydroxyanthracene-9,10-dione |
| SMILES | CCCCCCCc1ccc(Nc2cc(Oc3ccc(C4CCC(CCCC)CC4)cc3)c(O)c3c2C(=O)c2c(O)c(Oc4ccc(C5CCC(CCCC)CC5)cc4)cc(Nc4ccc(F)cc4)c2C3=O)cc1 |
| InChI | InChI=1S/C65H75FN2O6/c1-4-7-10-11-12-15-44-20-32-50(33-21-44)67-54-40-56(73-52-36-26-47(27-37-52)45-22-16-42(17-23-45)13-8-5-2)62(69)60-58(54)64(71)61-59(65(60)72)55(68-51-34-30-49(66)31-35-51)41-57(63(61)70)74-53-38-28-48(29-39-53)46-24-18-43(19-25-46)14-9-6-3/h20-21,26-43,45-46,67-70H,4-19,22-25H2,1-3H3 |
| InChIKey | VMIJBYXTNUWCBJ-UHFFFAOYSA-N |
| XLogP | 18.52 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.32 |
| LogP ≤ 5 | 18.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|