C24H35NO — CID 57048953
4-[4-(3-hept-1-enoxybutyl)cyclohexyl]benzonitrile (PubChem CID 57048953) has the molecular formula C24H35NO and a molecular weight of 353.55 g/mol. Its IUPAC name is 4-[4-(3-hept-1-enoxybutyl)cyclohexyl]benzonitrile.
| Compound Name | 4-[4-(3-hept-1-enoxybutyl)cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 57048953 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | 4-[4-(3-hept-1-enoxybutyl)cyclohexyl]benzonitrile |
| SMILES | CCCCCC=COC(C)CCC1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C24H35NO/c1-3-4-5-6-7-18-26-20(2)8-9-21-10-14-23(15-11-21)24-16-12-22(19-25)13-17-24/h7,12-13,16-18,20-21,23H,3-6,8-11,14-15H2,1-2H3 |
| InChIKey | OVOYYVPCMAPZDO-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|