C22H31NO — CID 19768986
4-[4-[[(E)-oct-3-enoxy]methyl]cyclohexyl]benzonitrile (PubChem CID 19768986) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 4-[4-[[(E)-oct-3-enoxy]methyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[[(E)-oct-3-enoxy]methyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 19768986 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 4-[4-[[(E)-oct-3-enoxy]methyl]cyclohexyl]benzonitrile |
| SMILES | CCCC/C=C/CCOCC1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C22H31NO/c1-2-3-4-5-6-7-16-24-18-20-10-14-22(15-11-20)21-12-8-19(17-23)9-13-21/h5-6,8-9,12-13,20,22H,2-4,7,10-11,14-16,18H2,1H3/b6-5+ |
| InChIKey | VXMWPXCBNRKNMM-AATRIKPKSA-N |
| XLogP | 5.99 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|