C20H27NO — CID 19769013
4-[4-[2-[(E)-pent-3-enoxy]ethyl]cyclohexyl]benzonitrile (PubChem CID 19769013) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 4-[4-[2-[(E)-pent-3-enoxy]ethyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[2-[(E)-pent-3-enoxy]ethyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 19769013 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 4-[4-[2-[(E)-pent-3-enoxy]ethyl]cyclohexyl]benzonitrile |
| SMILES | C/C=C/CCOCCC1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C20H27NO/c1-2-3-4-14-22-15-13-17-5-9-19(10-6-17)20-11-7-18(16-21)8-12-20/h2-3,7-8,11-12,17,19H,4-6,9-10,13-15H2,1H3/b3-2+ |
| InChIKey | PBPPQEZPYYJHEL-NSCUHMNNSA-N |
| XLogP | 5.20 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|