C19H25NO — CID 18651078
4-[4-(pent-4-enoxymethyl)cyclohexyl]benzonitrile (PubChem CID 18651078) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-[4-(pent-4-enoxymethyl)cyclohexyl]benzonitrile.
| Compound Name | 4-[4-(pent-4-enoxymethyl)cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 18651078 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 4-[4-(pent-4-enoxymethyl)cyclohexyl]benzonitrile |
| SMILES | C=CCCCOCC1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C19H25NO/c1-2-3-4-13-21-15-17-7-11-19(12-8-17)18-9-5-16(14-20)6-10-18/h2,5-6,9-10,17,19H,1,3-4,7-8,11-13,15H2 |
| InChIKey | GBEQCIWYQYKFAS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|