C23H33NO — CID 19768969
4-[4-[2-[(E)-oct-5-enoxy]ethyl]cyclohexyl]benzonitrile (PubChem CID 19768969) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is 4-[4-[2-[(E)-oct-5-enoxy]ethyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[2-[(E)-oct-5-enoxy]ethyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 19768969 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 4-[4-[2-[(E)-oct-5-enoxy]ethyl]cyclohexyl]benzonitrile |
| SMILES | CC/C=C/CCCCOCCC1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C23H33NO/c1-2-3-4-5-6-7-17-25-18-16-20-8-12-22(13-9-20)23-14-10-21(19-24)11-15-23/h3-4,10-11,14-15,20,22H,2,5-9,12-13,16-18H2,1H3/b4-3+ |
| InChIKey | BPUXBFMNPHRTOH-ONEGZZNKSA-N |
| XLogP | 6.38 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|