C33H56F2OSi — CID 173310554
4-(3,5-difluoro-4-nonan-2-yloxyphenyl)-1-(4-heptylcyclohexyl)silinane (PubChem CID 173310554) has the molecular formula C33H56F2OSi and a molecular weight of 534.89 g/mol. Its IUPAC name is 4-(3,5-difluoro-4-nonan-2-yloxyphenyl)-1-(4-heptylcyclohexyl)silinane.
| Compound Name | 4-(3,5-difluoro-4-nonan-2-yloxyphenyl)-1-(4-heptylcyclohexyl)silinane |
|---|---|
| PubChem CID | 173310554 |
| Molecular Formula | C33H56F2OSi |
| Molecular Weight | 534.89 g/mol |
| Exact Mass | 534.41 |
| IUPAC Name | 4-(3,5-difluoro-4-nonan-2-yloxyphenyl)-1-(4-heptylcyclohexyl)silinane |
| SMILES | CCCCCCCC1CCC([SiH]2CCC(c3cc(F)c(OC(C)CCCCCCC)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C33H56F2OSi/c1-4-6-8-10-12-14-26(3)36-33-31(34)24-29(25-32(33)35)28-20-22-37(23-21-28)30-18-16-27(17-19-30)15-13-11-9-7-5-2/h24-28,30,37H,4-23H2,1-3H3 |
| InChIKey | AVPWQJOZNYWWIY-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.89 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|