C31H42F2O — CID 20816614
1-[4-(3,5-difluoro-4-octan-2-yloxyphenyl)phenyl]-4-propylbicyclo[2.2.2]octane (PubChem CID 20816614) has the molecular formula C31H42F2O and a molecular weight of 468.67 g/mol. Its IUPAC name is 1-[4-(3,5-difluoro-4-octan-2-yloxyphenyl)phenyl]-4-propylbicyclo[2.2.2]octane.
| Compound Name | 1-[4-(3,5-difluoro-4-octan-2-yloxyphenyl)phenyl]-4-propylbicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 20816614 |
| Molecular Formula | C31H42F2O |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 1-[4-(3,5-difluoro-4-octan-2-yloxyphenyl)phenyl]-4-propylbicyclo[2.2.2]octane |
| SMILES | CCCCCCC(C)Oc1c(F)cc(-c2ccc(C34CCC(CCC)(CC3)CC4)cc2)cc1F |
| InChI | InChI=1S/C31H42F2O/c1-4-6-7-8-9-23(3)34-29-27(32)21-25(22-28(29)33)24-10-12-26(13-11-24)31-18-15-30(14-5-2,16-19-31)17-20-31/h10-13,21-23H,4-9,14-20H2,1-3H3 |
| InChIKey | WMEJRMJDHIVBIO-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|