C14H14F4O6 — CID 54525343
[4-(difluoromethoxy)-3,5-difluorophenyl] 5-ethoxy-1,3-dioxane-2-carboxylate (PubChem CID 54525343) has the molecular formula C14H14F4O6 and a molecular weight of 354.25 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3,5-difluorophenyl] 5-ethoxy-1,3-dioxane-2-carboxylate.
| Compound Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 5-ethoxy-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 54525343 |
| Molecular Formula | C14H14F4O6 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 5-ethoxy-1,3-dioxane-2-carboxylate |
| SMILES | CCOC1COC(C(=O)Oc2cc(F)c(OC(F)F)c(F)c2)OC1 |
| InChI | InChI=1S/C14H14F4O6/c1-2-20-8-5-21-13(22-6-8)12(19)23-7-3-9(15)11(10(16)4-7)24-14(17)18/h3-4,8,13-14H,2,5-6H2,1H3 |
| InChIKey | YSSQZOFZORIGML-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|