C25H32F2O4 — CID 165055517
[3,5-difluoro-4-(2-methylprop-2-enoyloxymethyl)phenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 165055517) has the molecular formula C25H32F2O4 and a molecular weight of 434.52 g/mol. Its IUPAC name is [3,5-difluoro-4-(2-methylprop-2-enoyloxymethyl)phenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [3,5-difluoro-4-(2-methylprop-2-enoyloxymethyl)phenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 165055517 |
| Molecular Formula | C25H32F2O4 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [3,5-difluoro-4-(2-methylprop-2-enoyloxymethyl)phenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCc1c(F)cc(OC(=O)C2CCC(C3CCC(C)CC3)CC2)cc1F |
| InChI | InChI=1S/C25H32F2O4/c1-15(2)24(28)30-14-21-22(26)12-20(13-23(21)27)31-25(29)19-10-8-18(9-11-19)17-6-4-16(3)5-7-17/h12-13,16-19H,1,4-11,14H2,2-3H3 |
| InChIKey | QIRJLEBATIFQAV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|