C30H36O4 — CID 126692784
[9-methyl-7-(4-methylcyclohexanecarbonyl)oxy-9H-fluoren-2-yl] 4-methylcyclohexane-1-carboxylate (PubChem CID 126692784) has the molecular formula C30H36O4 and a molecular weight of 460.61 g/mol. Its IUPAC name is [9-methyl-7-(4-methylcyclohexanecarbonyl)oxy-9H-fluoren-2-yl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | [9-methyl-7-(4-methylcyclohexanecarbonyl)oxy-9H-fluoren-2-yl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 126692784 |
| Molecular Formula | C30H36O4 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | [9-methyl-7-(4-methylcyclohexanecarbonyl)oxy-9H-fluoren-2-yl] 4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(=O)Oc2ccc3c(c2)C(C)c2cc(OC(=O)C4CCC(C)CC4)ccc2-3)CC1 |
| InChI | InChI=1S/C30H36O4/c1-18-4-8-21(9-5-18)29(31)33-23-12-14-25-26-15-13-24(17-28(26)20(3)27(25)16-23)34-30(32)22-10-6-19(2)7-11-22/h12-22H,4-11H2,1-3H3 |
| InChIKey | WBCXIFXHLFISPG-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|