C18H19F7O3 — CID 22080435
[3-fluoro-4-(1,1,2,3,3,3-hexafluoropropyl)phenyl] 4-(methoxymethyl)cyclohexane-1-carboxylate (PubChem CID 22080435) has the molecular formula C18H19F7O3 and a molecular weight of 416.33 g/mol. Its IUPAC name is [3-fluoro-4-(1,1,2,3,3,3-hexafluoropropyl)phenyl] 4-(methoxymethyl)cyclohexane-1-carboxylate.
| Compound Name | [3-fluoro-4-(1,1,2,3,3,3-hexafluoropropyl)phenyl] 4-(methoxymethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 22080435 |
| Molecular Formula | C18H19F7O3 |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [3-fluoro-4-(1,1,2,3,3,3-hexafluoropropyl)phenyl] 4-(methoxymethyl)cyclohexane-1-carboxylate |
| SMILES | COCC1CCC(C(=O)Oc2ccc(C(F)(F)C(F)C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H19F7O3/c1-27-9-10-2-4-11(5-3-10)15(26)28-12-6-7-13(14(19)8-12)17(21,22)16(20)18(23,24)25/h6-8,10-11,16H,2-5,9H2,1H3 |
| InChIKey | GZELSUSTNNVKLZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|