C21H16F5NO3S — CID 146335255
[2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazol-6-yl] cyclohexanecarboxylate (PubChem CID 146335255) has the molecular formula C21H16F5NO3S and a molecular weight of 457.42 g/mol. Its IUPAC name is [2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazol-6-yl] cyclohexanecarboxylate.
| Compound Name | [2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazol-6-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 146335255 |
| Molecular Formula | C21H16F5NO3S |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | [2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazol-6-yl] cyclohexanecarboxylate |
| SMILES | O=C(Oc1ccc2nc(C(F)(F)Oc3cc(F)c(F)c(F)c3)sc2c1)C1CCCCC1 |
| InChI | InChI=1S/C21H16F5NO3S/c22-14-8-13(9-15(23)18(14)24)30-21(25,26)20-27-16-7-6-12(10-17(16)31-20)29-19(28)11-4-2-1-3-5-11/h6-11H,1-5H2 |
| InChIKey | YXNKDVIHKQHDJW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|