C32H16F7NOS2 — CID 146335120
4-[4-[2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,3-benzothiazol-6-yl]-3-fluorophenyl]benzenethiol (PubChem CID 146335120) has the molecular formula C32H16F7NOS2 and a molecular weight of 627.61 g/mol. Its IUPAC name is 4-[4-[2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,3-benzothiazol-6-yl]-3-fluorophenyl]benzenethiol.
| Compound Name | 4-[4-[2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,3-benzothiazol-6-yl]-3-fluorophenyl]benzenethiol |
|---|---|
| PubChem CID | 146335120 |
| Molecular Formula | C32H16F7NOS2 |
| Molecular Weight | 627.61 g/mol |
| Exact Mass | 627.06 |
| IUPAC Name | 4-[4-[2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,3-benzothiazol-6-yl]-3-fluorophenyl]benzenethiol |
| SMILES | Fc1cc(OC(F)(F)c2nc3ccc(-c4ccc(-c5ccc(S)cc5)cc4F)cc3s2)ccc1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C32H16F7NOS2/c33-24-11-17(16-1-6-21(42)7-2-16)3-8-22(24)18-4-10-28-29(14-18)43-31(40-28)32(38,39)41-20-5-9-23(25(34)15-20)19-12-26(35)30(37)27(36)13-19/h1-15,42H |
| InChIKey | VGHVONOLEWXYBF-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 22.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.61 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|