C21H18F3O4Rb — CID 58058558
[2,3-difluoro-4-(4-methylcyclohexanecarbonyl)oxyphenyl] 2-fluorobenzene-4-ide-1-carboxylate;rubidium(1+) (PubChem CID 58058558) has the molecular formula C21H18F3O4Rb and a molecular weight of 476.83 g/mol. Its IUPAC name is [2,3-difluoro-4-(4-methylcyclohexanecarbonyl)oxyphenyl] 2-fluorobenzene-4-ide-1-carboxylate;rubidium(1+).
| Compound Name | [2,3-difluoro-4-(4-methylcyclohexanecarbonyl)oxyphenyl] 2-fluorobenzene-4-ide-1-carboxylate;rubidium(1+) |
|---|---|
| PubChem CID | 58058558 |
| Molecular Formula | C21H18F3O4Rb |
| Molecular Weight | 476.83 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | [2,3-difluoro-4-(4-methylcyclohexanecarbonyl)oxyphenyl] 2-fluorobenzene-4-ide-1-carboxylate;rubidium(1+) |
| SMILES | CC1CCC(C(=O)Oc2ccc(OC(=O)c3cc[c-]cc3F)c(F)c2F)CC1.[Rb+] |
| InChI | InChI=1S/C21H18F3O4.Rb/c1-12-6-8-13(9-7-12)20(25)27-16-10-11-17(19(24)18(16)23)28-21(26)14-4-2-3-5-15(14)22;/h2,4-5,10-13H,6-9H2,1H3;/q-1;+1 |
| InChIKey | BZKQYNPJRIFKQB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.83 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|