C26H36ClF3O — CID 139947269
1-chloro-3-(difluoromethoxy)-2-fluoro-4-[4-[2-(4-pent-4-enylcyclohexyl)ethyl]cyclohexyl]benzene (PubChem CID 139947269) has the molecular formula C26H36ClF3O and a molecular weight of 457.02 g/mol. Its IUPAC name is 1-chloro-3-(difluoromethoxy)-2-fluoro-4-[4-[2-(4-pent-4-enylcyclohexyl)ethyl]cyclohexyl]benzene.
| Compound Name | 1-chloro-3-(difluoromethoxy)-2-fluoro-4-[4-[2-(4-pent-4-enylcyclohexyl)ethyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 139947269 |
| Molecular Formula | C26H36ClF3O |
| Molecular Weight | 457.02 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 1-chloro-3-(difluoromethoxy)-2-fluoro-4-[4-[2-(4-pent-4-enylcyclohexyl)ethyl]cyclohexyl]benzene |
| SMILES | C=CCCCC1CCC(CCC2CCC(c3ccc(Cl)c(F)c3OC(F)F)CC2)CC1 |
| InChI | InChI=1S/C26H36ClF3O/c1-2-3-4-5-18-6-8-19(9-7-18)10-11-20-12-14-21(15-13-20)22-16-17-23(27)24(28)25(22)31-26(29)30/h2,16-21,26H,1,3-15H2 |
| InChIKey | PSYQUYJBRMZOJW-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.02 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|