C18H21F5O — CID 175686321
1-(4-but-3-enylcyclohexyl)-2,3-difluoro-4-(2,2,2-trifluoroethoxy)benzene (PubChem CID 175686321) has the molecular formula C18H21F5O and a molecular weight of 348.36 g/mol. Its IUPAC name is 1-(4-but-3-enylcyclohexyl)-2,3-difluoro-4-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 1-(4-but-3-enylcyclohexyl)-2,3-difluoro-4-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 175686321 |
| Molecular Formula | C18H21F5O |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-(4-but-3-enylcyclohexyl)-2,3-difluoro-4-(2,2,2-trifluoroethoxy)benzene |
| SMILES | C=CCCC1CCC(c2ccc(OCC(F)(F)F)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H21F5O/c1-2-3-4-12-5-7-13(8-6-12)14-9-10-15(17(20)16(14)19)24-11-18(21,22)23/h2,9-10,12-13H,1,3-8,11H2 |
| InChIKey | ZCLIGOBLDWIZTQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|