C22H21F3O — CID 134473121
6-(4-but-3-enylcyclohexyl)-3,4,5-trifluorobiphenylen-2-ol (PubChem CID 134473121) has the molecular formula C22H21F3O and a molecular weight of 358.40 g/mol. Its IUPAC name is 6-(4-but-3-enylcyclohexyl)-3,4,5-trifluorobiphenylen-2-ol.
| Compound Name | 6-(4-but-3-enylcyclohexyl)-3,4,5-trifluorobiphenylen-2-ol |
|---|---|
| PubChem CID | 134473121 |
| Molecular Formula | C22H21F3O |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 6-(4-but-3-enylcyclohexyl)-3,4,5-trifluorobiphenylen-2-ol |
| SMILES | C=CCCC1CCC(c2ccc3c(c2F)-c2c-3cc(O)c(F)c2F)CC1 |
| InChI | InChI=1S/C22H21F3O/c1-2-3-4-12-5-7-13(8-6-12)14-9-10-15-16-11-17(26)21(24)22(25)19(16)18(15)20(14)23/h2,9-13,26H,1,3-8H2 |
| InChIKey | HAWLZEVVQDWFKH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|