C20H17F3O — CID 134473213
6-(4-ethenylcyclohexyl)-3,4,5-trifluorobiphenylen-2-ol (PubChem CID 134473213) has the molecular formula C20H17F3O and a molecular weight of 330.35 g/mol. Its IUPAC name is 6-(4-ethenylcyclohexyl)-3,4,5-trifluorobiphenylen-2-ol.
| Compound Name | 6-(4-ethenylcyclohexyl)-3,4,5-trifluorobiphenylen-2-ol |
|---|---|
| PubChem CID | 134473213 |
| Molecular Formula | C20H17F3O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 6-(4-ethenylcyclohexyl)-3,4,5-trifluorobiphenylen-2-ol |
| SMILES | C=CC1CCC(c2ccc3c(c2F)-c2c-3cc(O)c(F)c2F)CC1 |
| InChI | InChI=1S/C20H17F3O/c1-2-10-3-5-11(6-4-10)12-7-8-13-14-9-15(24)19(22)20(23)17(14)16(13)18(12)21/h2,7-11,24H,1,3-6H2 |
| InChIKey | GWMQMYUIHQBAMM-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|