C28H45F2O4P — CID 157093204
1-[3-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]propoxy]-2,3-difluoro-4-(4-pent-4-enylcyclohexyl)benzene (PubChem CID 157093204) has the molecular formula C28H45F2O4P and a molecular weight of 514.63 g/mol. Its IUPAC name is 1-[3-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]propoxy]-2,3-difluoro-4-(4-pent-4-enylcyclohexyl)benzene.
| Compound Name | 1-[3-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]propoxy]-2,3-difluoro-4-(4-pent-4-enylcyclohexyl)benzene |
|---|---|
| PubChem CID | 157093204 |
| Molecular Formula | C28H45F2O4P |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | 1-[3-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]propoxy]-2,3-difluoro-4-(4-pent-4-enylcyclohexyl)benzene |
| SMILES | C=CCCCC1CCC(c2ccc(OCCCP(=O)(OC(C)(C)C)OC(C)(C)C)c(F)c2F)CC1 |
| InChI | InChI=1S/C28H45F2O4P/c1-8-9-10-12-21-13-15-22(16-14-21)23-17-18-24(26(30)25(23)29)32-19-11-20-35(31,33-27(2,3)4)34-28(5,6)7/h8,17-18,21-22H,1,9-16,19-20H2,2-7H3 |
| InChIKey | FMOCINHMDHJZSN-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|