C24H31ClF2 — CID 21032732
(2R,4aS,4bS,8aS,10aR)-2-but-3-enyl-7-(4-chloro-3,5-difluorophenyl)-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene (PubChem CID 21032732) has the molecular formula C24H31ClF2 and a molecular weight of 392.96 g/mol. Its IUPAC name is (2R,4aS,4bS,8aS,10aR)-2-but-3-enyl-7-(4-chloro-3,5-difluorophenyl)-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene.
| Compound Name | (2R,4aS,4bS,8aS,10aR)-2-but-3-enyl-7-(4-chloro-3,5-difluorophenyl)-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
|---|---|
| PubChem CID | 21032732 |
| Molecular Formula | C24H31ClF2 |
| Molecular Weight | 392.96 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (2R,4aS,4bS,8aS,10aR)-2-but-3-enyl-7-(4-chloro-3,5-difluorophenyl)-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
| SMILES | C=CCC[C@@H]1CC[C@H]2[C@H](CC[C@H]3CC(c4cc(F)c(Cl)c(F)c4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C24H31ClF2/c1-2-3-4-15-5-9-20-17(11-15)6-7-18-12-16(8-10-21(18)20)19-13-22(26)24(25)23(27)14-19/h2,13-18,20-21H,1,3-12H2/t15-,16?,17-,18+,20+,21+/m1/s1 |
| InChIKey | VXSZKUGOMQETKV-DOCIGUABSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.96 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|