C33H40O — CID 139868056
2-[4-[2-[4-[(E)-but-2-enoxy]phenyl]ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139868056) has the molecular formula C33H40O and a molecular weight of 452.68 g/mol. Its IUPAC name is 2-[4-[2-[4-[(E)-but-2-enoxy]phenyl]ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[2-[4-[(E)-but-2-enoxy]phenyl]ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139868056 |
| Molecular Formula | C33H40O |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | 2-[4-[2-[4-[(E)-but-2-enoxy]phenyl]ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/CCC1CCC2CC(c3ccc(C#Cc4ccc(OC/C=C/C)cc4)cc3)CCC2C1 |
| InChI | InChI=1S/C33H40O/c1-3-5-7-8-28-13-18-32-25-31(20-19-30(32)24-28)29-16-11-26(12-17-29)9-10-27-14-21-33(22-15-27)34-23-6-4-2/h3-6,11-12,14-17,21-22,28,30-32H,7-8,13,18-20,23-25H2,1-2H3/b5-3+,6-4+ |
| InChIKey | UKHWRMANRXHAAZ-GGWOSOGESA-N |
| XLogP | 8.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|