C23H23F3O2 — CID 70820076
4-[2-[4-[4-(ethoxymethyl)-2-fluorophenyl]cyclohexyl]ethynyl]-2,3-difluorophenol (PubChem CID 70820076) has the molecular formula C23H23F3O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 4-[2-[4-[4-(ethoxymethyl)-2-fluorophenyl]cyclohexyl]ethynyl]-2,3-difluorophenol.
| Compound Name | 4-[2-[4-[4-(ethoxymethyl)-2-fluorophenyl]cyclohexyl]ethynyl]-2,3-difluorophenol |
|---|---|
| PubChem CID | 70820076 |
| Molecular Formula | C23H23F3O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 4-[2-[4-[4-(ethoxymethyl)-2-fluorophenyl]cyclohexyl]ethynyl]-2,3-difluorophenol |
| SMILES | CCOCc1ccc(C2CCC(C#Cc3ccc(O)c(F)c3F)CC2)c(F)c1 |
| InChI | InChI=1S/C23H23F3O2/c1-2-28-14-16-6-11-19(20(24)13-16)17-7-3-15(4-8-17)5-9-18-10-12-21(27)23(26)22(18)25/h6,10-13,15,17,27H,2-4,7-8,14H2,1H3 |
| InChIKey | UOCVYDHGAVXTQU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|