C23H21F3O2 — CID 88997603
2-[2,3-difluoro-4-[4-[2-(2-fluoro-4-methoxyphenyl)ethynyl]cyclohexyl]phenyl]oxirane (PubChem CID 88997603) has the molecular formula C23H21F3O2 and a molecular weight of 386.41 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-[4-[2-(2-fluoro-4-methoxyphenyl)ethynyl]cyclohexyl]phenyl]oxirane.
| Compound Name | 2-[2,3-difluoro-4-[4-[2-(2-fluoro-4-methoxyphenyl)ethynyl]cyclohexyl]phenyl]oxirane |
|---|---|
| PubChem CID | 88997603 |
| Molecular Formula | C23H21F3O2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[2,3-difluoro-4-[4-[2-(2-fluoro-4-methoxyphenyl)ethynyl]cyclohexyl]phenyl]oxirane |
| SMILES | COc1ccc(C#CC2CCC(c3ccc(C4CO4)c(F)c3F)CC2)c(F)c1 |
| InChI | InChI=1S/C23H21F3O2/c1-27-17-9-8-16(20(24)12-17)7-4-14-2-5-15(6-3-14)18-10-11-19(21-13-28-21)23(26)22(18)25/h8-12,14-15,21H,2-3,5-6,13H2,1H3 |
| InChIKey | AGBGTDZQYIJZGQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|