C28H27F3O3 — CID 88964208
2-[4-[[4-[2,3-difluoro-4-(4-methoxyphenyl)phenyl]cyclohexyl]oxymethyl]-3-fluorophenyl]oxirane (PubChem CID 88964208) has the molecular formula C28H27F3O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is 2-[4-[[4-[2,3-difluoro-4-(4-methoxyphenyl)phenyl]cyclohexyl]oxymethyl]-3-fluorophenyl]oxirane.
| Compound Name | 2-[4-[[4-[2,3-difluoro-4-(4-methoxyphenyl)phenyl]cyclohexyl]oxymethyl]-3-fluorophenyl]oxirane |
|---|---|
| PubChem CID | 88964208 |
| Molecular Formula | C28H27F3O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 2-[4-[[4-[2,3-difluoro-4-(4-methoxyphenyl)phenyl]cyclohexyl]oxymethyl]-3-fluorophenyl]oxirane |
| SMILES | COc1ccc(-c2ccc(C3CCC(OCc4ccc(C5CO5)cc4F)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C28H27F3O3/c1-32-21-8-4-17(5-9-21)23-12-13-24(28(31)27(23)30)18-6-10-22(11-7-18)33-15-20-3-2-19(14-25(20)29)26-16-34-26/h2-5,8-9,12-14,18,22,26H,6-7,10-11,15-16H2,1H3 |
| InChIKey | HIJNVTZCAJYNHZ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|